C18H28FNO2Si — CID 101170041
(3R,5S)-1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one (PubChem CID 101170041) has the molecular formula C18H28FNO2Si and a molecular weight of 337.51 g/mol. Its IUPAC name is (3R,5S)-1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one.
| Compound Name | (3R,5S)-1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one |
|---|---|
| PubChem CID | 101170041 |
| Molecular Formula | C18H28FNO2Si |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (3R,5S)-1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@@H](F)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H28FNO2Si/c1-18(2,3)23(4,5)22-13-15-11-16(19)17(21)20(15)12-14-9-7-6-8-10-14/h6-10,15-16H,11-13H2,1-5H3/t15-,16+/m0/s1 |
| InChIKey | PVTGZMRPZRVAPG-JKSUJKDBSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|