C19H26FNO2Si — CID 58703936
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethynyl-5-fluorophenyl)pyrrolidin-2-one (PubChem CID 58703936) has the molecular formula C19H26FNO2Si and a molecular weight of 347.51 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethynyl-5-fluorophenyl)pyrrolidin-2-one.
| Compound Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethynyl-5-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 58703936 |
| Molecular Formula | C19H26FNO2Si |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethynyl-5-fluorophenyl)pyrrolidin-2-one |
| SMILES | C#Cc1ccc(F)cc1N1C(=O)CC[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H26FNO2Si/c1-7-14-8-9-15(20)12-17(14)21-16(10-11-18(21)22)13-23-24(5,6)19(2,3)4/h1,8-9,12,16H,10-11,13H2,2-6H3/t16-/m0/s1 |
| InChIKey | CJADGJLEKJSNOQ-INIZCTEOSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|