C18H26F3NO2Si — CID 11349313
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 11349313) has the molecular formula C18H26F3NO2Si and a molecular weight of 373.49 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11349313 |
| Molecular Formula | C18H26F3NO2Si |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H26F3NO2Si/c1-17(2,3)25(4,5)24-12-15-10-11-16(23)22(15)14-8-6-13(7-9-14)18(19,20)21/h6-9,15H,10-12H2,1-5H3/t15-/m0/s1 |
| InChIKey | UYUGASRNHOYUNS-HNNXBMFYSA-N |
| XLogP | 5.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|