C19H23FN2O2Si — CID 143149712
2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethynyl]-5-oxopyrrolidin-1-yl]-4-fluorobenzonitrile (PubChem CID 143149712) has the molecular formula C19H23FN2O2Si and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethynyl]-5-oxopyrrolidin-1-yl]-4-fluorobenzonitrile.
| Compound Name | 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethynyl]-5-oxopyrrolidin-1-yl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 143149712 |
| Molecular Formula | C19H23FN2O2Si |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethynyl]-5-oxopyrrolidin-1-yl]-4-fluorobenzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC#CC1CCC(=O)N1c1cc(F)ccc1C#N |
| InChI | InChI=1S/C19H23FN2O2Si/c1-19(2,3)25(4,5)24-11-10-16-8-9-18(23)22(16)17-12-15(20)7-6-14(17)13-21/h6-7,12,16H,8-9H2,1-5H3 |
| InChIKey | HECTUTHJRKGFBX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|