C18H25F3N2O4Si — CID 11177568
(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 11177568) has the molecular formula C18H25F3N2O4Si and a molecular weight of 418.49 g/mol. Its IUPAC name is (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11177568 |
| Molecular Formula | C18H25F3N2O4Si |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCC(=O)N1c1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F3N2O4Si/c1-17(2,3)28(4,5)27-11-13-7-9-16(24)22(13)12-6-8-15(23(25)26)14(10-12)18(19,20)21/h6,8,10,13H,7,9,11H2,1-5H3/t13-/m1/s1 |
| InChIKey | WAAXEUYYTRVBEU-CYBMUJFWSA-N |
| XLogP | 5.13 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|