C28H33NO2Si — CID 11070292
(5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one (PubChem CID 11070292) has the molecular formula C28H33NO2Si and a molecular weight of 443.66 g/mol. Its IUPAC name is (5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11070292 |
| Molecular Formula | C28H33NO2Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC(=O)N1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO2Si/c1-28(2,3)32(25-15-9-5-10-16-25,26-17-11-6-12-18-26)31-22-24-19-20-27(30)29(24)21-23-13-7-4-8-14-23/h4-18,24H,19-22H2,1-3H3/t24-/m0/s1 |
| InChIKey | OXFKAXZLFHKXJZ-DEOSSOPVSA-N |
| XLogP | 4.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|