C28H32FNO2Si — CID 101170042
(3R,5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one (PubChem CID 101170042) has the molecular formula C28H32FNO2Si and a molecular weight of 461.65 g/mol. Its IUPAC name is (3R,5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one.
| Compound Name | (3R,5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one |
|---|---|
| PubChem CID | 101170042 |
| Molecular Formula | C28H32FNO2Si |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (3R,5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoropyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](F)C(=O)N1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32FNO2Si/c1-28(2,3)33(24-15-9-5-10-16-24,25-17-11-6-12-18-25)32-21-23-19-26(29)27(31)30(23)20-22-13-7-4-8-14-22/h4-18,23,26H,19-21H2,1-3H3/t23-,26+/m0/s1 |
| InChIKey | LXDHRIBLFKZGRF-JYFHCDHNSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|