C28H35NOSi — CID 46873547
[(2S)-1-benzylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 46873547) has the molecular formula C28H35NOSi and a molecular weight of 429.68 g/mol. Its IUPAC name is [(2S)-1-benzylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-1-benzylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 46873547 |
| Molecular Formula | C28H35NOSi |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [(2S)-1-benzylpyrrolidin-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCCN1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35NOSi/c1-28(2,3)31(26-17-9-5-10-18-26,27-19-11-6-12-20-27)30-23-25-16-13-21-29(25)22-24-14-7-4-8-15-24/h4-12,14-15,17-20,25H,13,16,21-23H2,1-3H3/t25-/m0/s1 |
| InChIKey | BYXQOSFVEWLLDS-VWLOTQADSA-N |
| XLogP | 5.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|