C23H35NOSe — CID 11811857
(2S)-1-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]selanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine (PubChem CID 11811857) has the molecular formula C23H35NOSe and a molecular weight of 420.50 g/mol. Its IUPAC name is (2S)-1-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]selanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine.
| Compound Name | (2S)-1-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]selanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 11811857 |
| Molecular Formula | C23H35NOSe |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (2S)-1-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]selanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine |
| SMILES | COC[C@@H]1CCCN1Cc1ccccc1[Se]C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H35NOSe/c1-19(2)9-7-10-20(3)14-16-26-23-13-6-5-11-21(23)17-24-15-8-12-22(24)18-25-4/h5-6,9,11,13-14,22H,7-8,10,12,15-18H2,1-4H3/b20-14+/t22-/m0/s1 |
| InChIKey | SPFAZZAYCJDCJW-FGGAIWKESA-N |
| XLogP | 4.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|