C20H33NOSi — CID 12069185
tert-butyl-dimethyl-[[(2S)-1-[(E)-3-phenylprop-2-enyl]pyrrolidin-2-yl]methoxy]silane (PubChem CID 12069185) has the molecular formula C20H33NOSi and a molecular weight of 331.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S)-1-[(E)-3-phenylprop-2-enyl]pyrrolidin-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S)-1-[(E)-3-phenylprop-2-enyl]pyrrolidin-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 12069185 |
| Molecular Formula | C20H33NOSi |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S)-1-[(E)-3-phenylprop-2-enyl]pyrrolidin-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCCN1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H33NOSi/c1-20(2,3)23(4,5)22-17-19-14-10-16-21(19)15-9-13-18-11-7-6-8-12-18/h6-9,11-13,19H,10,14-17H2,1-5H3/b13-9+/t19-/m0/s1 |
| InChIKey | JTZYBHNSNNGLQB-CWIMXHLESA-N |
| XLogP | 5.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|