C30H33F4NOSi — CID 176727464
tert-butyl-[[(2R,5R,8S)-2-fluoro-5-(3,4,5-trifluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane (PubChem CID 176727464) has the molecular formula C30H33F4NOSi and a molecular weight of 527.68 g/mol. Its IUPAC name is tert-butyl-[[(2R,5R,8S)-2-fluoro-5-(3,4,5-trifluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,5R,8S)-2-fluoro-5-(3,4,5-trifluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 176727464 |
| Molecular Formula | C30H33F4NOSi |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | tert-butyl-[[(2R,5R,8S)-2-fluoro-5-(3,4,5-trifluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@]12CC[C@H](c3cc(F)c(F)c(F)c3)N1C[C@H](F)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33F4NOSi/c1-29(2,3)37(23-10-6-4-7-11-23,24-12-8-5-9-13-24)36-20-30-15-14-27(35(30)19-22(31)18-30)21-16-25(32)28(34)26(33)17-21/h4-13,16-17,22,27H,14-15,18-20H2,1-3H3/t22-,27-,30+/m1/s1 |
| InChIKey | MDWHIHXKJWCKIY-MBBMMDPKSA-N |
| XLogP | 6.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|