C22H36INOSi — CID 10648595
[(2S,3S,4S)-1-benzyl-3-(iodomethyl)-4-prop-1-en-2-ylpyrrolidin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10648595) has the molecular formula C22H36INOSi and a molecular weight of 485.53 g/mol. Its IUPAC name is [(2S,3S,4S)-1-benzyl-3-(iodomethyl)-4-prop-1-en-2-ylpyrrolidin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,4S)-1-benzyl-3-(iodomethyl)-4-prop-1-en-2-ylpyrrolidin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10648595 |
| Molecular Formula | C22H36INOSi |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [(2S,3S,4S)-1-benzyl-3-(iodomethyl)-4-prop-1-en-2-ylpyrrolidin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@H]1CN(Cc2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CI |
| InChI | InChI=1S/C22H36INOSi/c1-17(2)20-15-24(14-18-11-9-8-10-12-18)21(19(20)13-23)16-25-26(6,7)22(3,4)5/h8-12,19-21H,1,13-16H2,2-7H3/t19-,20+,21+/m0/s1 |
| InChIKey | YUSCRKCJQIJRLO-PWRODBHTSA-N |
| XLogP | 6.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|