C20H35NOSi — CID 131632183
[(2S,5R)-5-phenylpyrrolidin-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 131632183) has the molecular formula C20H35NOSi and a molecular weight of 333.59 g/mol. Its IUPAC name is [(2S,5R)-5-phenylpyrrolidin-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2S,5R)-5-phenylpyrrolidin-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 131632183 |
| Molecular Formula | C20H35NOSi |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | [(2S,5R)-5-phenylpyrrolidin-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@H]1CC[C@H](c2ccccc2)N1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H35NOSi/c1-15(2)23(16(3)4,17(5)6)22-14-19-12-13-20(21-19)18-10-8-7-9-11-18/h7-11,15-17,19-21H,12-14H2,1-6H3/t19-,20+/m0/s1 |
| InChIKey | HOPMEJCYHDJTOS-VQTJNVASSA-N |
| XLogP | 5.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|