C27H30FNO2Si — CID 11525174
(4S,5S)-1-benzyl-4-(tert-butyl-fluoro-phenylsilyl)oxy-5-phenylpyrrolidin-2-one (PubChem CID 11525174) has the molecular formula C27H30FNO2Si and a molecular weight of 447.63 g/mol. Its IUPAC name is (4S,5S)-1-benzyl-4-(tert-butyl-fluoro-phenylsilyl)oxy-5-phenylpyrrolidin-2-one.
| Compound Name | (4S,5S)-1-benzyl-4-(tert-butyl-fluoro-phenylsilyl)oxy-5-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11525174 |
| Molecular Formula | C27H30FNO2Si |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (4S,5S)-1-benzyl-4-(tert-butyl-fluoro-phenylsilyl)oxy-5-phenylpyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](F)(O[C@H]1CC(=O)N(Cc2ccccc2)[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30FNO2Si/c1-27(2,3)32(28,23-17-11-6-12-18-23)31-24-19-25(30)29(20-21-13-7-4-8-14-21)26(24)22-15-9-5-10-16-22/h4-18,24,26H,19-20H2,1-3H3/t24-,26-,32?/m0/s1 |
| InChIKey | WDZZBVBOYQSGJJ-UOFAHNJFSA-N |
| XLogP | 5.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|