C29H35NO2Si — CID 139181189
(3R,4S,5R)-1-tert-butyl-4-[dimethyl(phenyl)silyl]-3-[(S)-hydroxy(phenyl)methyl]-5-phenylpyrrolidin-2-one (PubChem CID 139181189) has the molecular formula C29H35NO2Si and a molecular weight of 457.69 g/mol. Its IUPAC name is (3R,4S,5R)-1-tert-butyl-4-[dimethyl(phenyl)silyl]-3-[(S)-hydroxy(phenyl)methyl]-5-phenylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-1-tert-butyl-4-[dimethyl(phenyl)silyl]-3-[(S)-hydroxy(phenyl)methyl]-5-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 139181189 |
| Molecular Formula | C29H35NO2Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (3R,4S,5R)-1-tert-butyl-4-[dimethyl(phenyl)silyl]-3-[(S)-hydroxy(phenyl)methyl]-5-phenylpyrrolidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@@H]([C@H](O)c2ccccc2)[C@H]([Si](C)(C)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H35NO2Si/c1-29(2,3)30-25(21-15-9-6-10-16-21)27(33(4,5)23-19-13-8-14-20-23)24(28(30)32)26(31)22-17-11-7-12-18-22/h6-20,24-27,31H,1-5H3/t24-,25+,26+,27-/m0/s1 |
| InChIKey | JUTBHPJARVNABL-YAOOYPAMSA-N |
| XLogP | 5.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|