C26H29NO2 — CID 11176699
(1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2-methyl-1-phenylpentan-3-one (PubChem CID 11176699) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2-methyl-1-phenylpentan-3-one.
| Compound Name | (1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2-methyl-1-phenylpentan-3-one |
|---|---|
| PubChem CID | 11176699 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2-methyl-1-phenylpentan-3-one |
| SMILES | C[C@@H](C(=O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-20(26(29)24-16-10-5-11-17-24)25(28)21(2)27(18-22-12-6-3-7-13-22)19-23-14-8-4-9-15-23/h3-17,20-21,26,29H,18-19H2,1-2H3/t20-,21-,26+/m0/s1 |
| InChIKey | GCYQFIORJPCTFI-ISJBWFOZSA-N |
| XLogP | 5.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |