C25H25NO2 — CID 11394641
(4S,5R)-1,5-dibenzyl-4-phenylmethoxypyrrolidin-2-one (PubChem CID 11394641) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (4S,5R)-1,5-dibenzyl-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4S,5R)-1,5-dibenzyl-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11394641 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (4S,5R)-1,5-dibenzyl-4-phenylmethoxypyrrolidin-2-one |
| SMILES | O=C1C[C@H](OCc2ccccc2)[C@@H](Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H25NO2/c27-25-17-24(28-19-22-14-8-3-9-15-22)23(16-20-10-4-1-5-11-20)26(25)18-21-12-6-2-7-13-21/h1-15,23-24H,16-19H2/t23-,24+/m1/s1 |
| InChIKey | UEBFWDIHBKYRSE-RPWUZVMVSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |