C32H41NO2Si — CID 56953832
(2S)-N-benzyl-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methylpent-4-enamide (PubChem CID 56953832) has the molecular formula C32H41NO2Si and a molecular weight of 499.77 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methylpent-4-enamide.
| Compound Name | (2S)-N-benzyl-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methylpent-4-enamide |
|---|---|
| PubChem CID | 56953832 |
| Molecular Formula | C32H41NO2Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (2S)-N-benzyl-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-methylpent-4-enamide |
| SMILES | C=C(C)C[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H41NO2Si/c1-26(2)24-28(31(34)33-25-27-16-9-6-10-17-27)18-15-23-35-36(32(3,4)5,29-19-11-7-12-20-29)30-21-13-8-14-22-30/h6-14,16-17,19-22,28H,1,15,18,23-25H2,2-5H3,(H,33,34)/t28-/m0/s1 |
| InChIKey | RIEVYHLVRIMRPP-NDEPHWFRSA-N |
| XLogP | 6.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|