C27H33NO2Si — CID 11037409
N-benzyl-4-[tert-butyl(diphenyl)silyl]oxybutanamide (PubChem CID 11037409) has the molecular formula C27H33NO2Si and a molecular weight of 431.65 g/mol. Its IUPAC name is N-benzyl-4-[tert-butyl(diphenyl)silyl]oxybutanamide.
| Compound Name | N-benzyl-4-[tert-butyl(diphenyl)silyl]oxybutanamide |
|---|---|
| PubChem CID | 11037409 |
| Molecular Formula | C27H33NO2Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N-benzyl-4-[tert-butyl(diphenyl)silyl]oxybutanamide |
| SMILES | CC(C)(C)[Si](OCCCC(=O)NCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO2Si/c1-27(2,3)31(24-16-9-5-10-17-24,25-18-11-6-12-19-25)30-21-13-20-26(29)28-22-23-14-7-4-8-15-23/h4-12,14-19H,13,20-22H2,1-3H3,(H,28,29) |
| InChIKey | VICFVRTTXZBPQO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|