C24H36N2O2Si2 — CID 10503283
(2S,3R)-N,N'-dibenzyl-2,3-bis(trimethylsilyl)butanediamide (PubChem CID 10503283) has the molecular formula C24H36N2O2Si2 and a molecular weight of 440.74 g/mol. Its IUPAC name is (2S,3R)-N,N'-dibenzyl-2,3-bis(trimethylsilyl)butanediamide.
| Compound Name | (2S,3R)-N,N'-dibenzyl-2,3-bis(trimethylsilyl)butanediamide |
|---|---|
| PubChem CID | 10503283 |
| Molecular Formula | C24H36N2O2Si2 |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (2S,3R)-N,N'-dibenzyl-2,3-bis(trimethylsilyl)butanediamide |
| SMILES | C[Si](C)(C)[C@H](C(=O)NCc1ccccc1)[C@H](C(=O)NCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H36N2O2Si2/c1-29(2,3)21(23(27)25-17-19-13-9-7-10-14-19)22(30(4,5)6)24(28)26-18-20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3,(H,25,27)(H,26,28)/t21-,22+ |
| InChIKey | SUCQABJYAFPLOS-SZPZYZBQSA-N |
| XLogP | 5.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|