C22H28N2O2 — CID 2931469
N,N'-bis(3-phenylpropyl)butanediamide (PubChem CID 2931469) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N,N'-bis(3-phenylpropyl)butanediamide.
| Compound Name | N,N'-bis(3-phenylpropyl)butanediamide |
|---|---|
| PubChem CID | 2931469 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N,N'-bis(3-phenylpropyl)butanediamide |
| SMILES | O=C(CCC(=O)NCCCc1ccccc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O2/c25-21(23-17-7-13-19-9-3-1-4-10-19)15-16-22(26)24-18-8-14-20-11-5-2-6-12-20/h1-6,9-12H,7-8,13-18H2,(H,23,25)(H,24,26) |
| InChIKey | WSBDCQQEFPJAKT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|