About N,N'-dibenzylpropanediamide
N,N'-dibenzylpropanediamide (PubChem CID 735256) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is N,N'-dibenzylpropanediamide.
Molecular Properties
| Compound Name | N,N'-dibenzylpropanediamide |
| PubChem CID | 735256 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N,N'-dibenzylpropanediamide |
| SMILES | O=C(CC(=O)NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O2/c20-16(18-12-14-7-3-1-4-8-14)11-17(21)19-13-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,18,20)(H,19,21) |
| InChIKey | RHHVWHPMKFVUGF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dibenzylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dibenzylpropanediamide?
The IUPAC name of N,N'-dibenzylpropanediamide (CID 735256) is N,N'-dibenzylpropanediamide.
What is the SMILES notation for N,N'-dibenzylpropanediamide?
The canonical SMILES for N,N'-dibenzylpropanediamide is O=C(CC(=O)NCc1ccccc1)NCc1ccccc1.
What is the InChIKey of N,N'-dibenzylpropanediamide?
The InChIKey is RHHVWHPMKFVUGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2/c20-16(18-12-14-7-3-1-4-8-14)11-17(21)19-13-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,18,20)(H,19,21).
What are the key properties of N,N'-dibenzylpropanediamide?
N,N'-dibenzylpropanediamide has a molecular weight of 282.34 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dibenzylpropanediamide is sourced from PubChem (CID 735256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).