C27H37NO — CID 162516979
(5Z,8Z,11Z,14Z,17Z)-N-benzylicosa-5,8,11,14,17-pentaenamide (PubChem CID 162516979) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-benzylicosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-benzylicosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 162516979 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-benzylicosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-27(29)28-25-26-22-19-18-20-23-26/h3-4,6-7,9-10,12-13,15-16,18-20,22-23H,2,5,8,11,14,17,21,24-25H2,1H3,(H,28,29)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | VIMYRMWXQWTCCQ-JLNKQSITSA-N |
| XLogP | 7.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|