C29H35NO2 — CID 123215791
N,4-dibenzyl-2-(methoxymethyl)-3-methyl-6-phenylhexanamide (PubChem CID 123215791) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is N,4-dibenzyl-2-(methoxymethyl)-3-methyl-6-phenylhexanamide.
| Compound Name | N,4-dibenzyl-2-(methoxymethyl)-3-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 123215791 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | N,4-dibenzyl-2-(methoxymethyl)-3-methyl-6-phenylhexanamide |
| SMILES | COCC(C(=O)NCc1ccccc1)C(C)C(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H35NO2/c1-23(28(22-32-2)29(31)30-21-26-16-10-5-11-17-26)27(20-25-14-8-4-9-15-25)19-18-24-12-6-3-7-13-24/h3-17,23,27-28H,18-22H2,1-2H3,(H,30,31) |
| InChIKey | HUJMOIPTSLSENO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |