C28H34N2O2Si — CID 10837595
N,N'-dibenzyl-3-[dimethyl(phenyl)silyl]hexanediamide (PubChem CID 10837595) has the molecular formula C28H34N2O2Si and a molecular weight of 458.68 g/mol. Its IUPAC name is N,N'-dibenzyl-3-[dimethyl(phenyl)silyl]hexanediamide.
| Compound Name | N,N'-dibenzyl-3-[dimethyl(phenyl)silyl]hexanediamide |
|---|---|
| PubChem CID | 10837595 |
| Molecular Formula | C28H34N2O2Si |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N,N'-dibenzyl-3-[dimethyl(phenyl)silyl]hexanediamide |
| SMILES | C[Si](C)(c1ccccc1)C(CCC(=O)NCc1ccccc1)CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H34N2O2Si/c1-33(2,25-16-10-5-11-17-25)26(20-28(32)30-22-24-14-8-4-9-15-24)18-19-27(31)29-21-23-12-6-3-7-13-23/h3-17,26H,18-22H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | UMMRMARDBKZJPI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|