C26H39NO2Si — CID 139707574
N,2-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxy-N-methylpentanamide (PubChem CID 139707574) has the molecular formula C26H39NO2Si and a molecular weight of 425.69 g/mol. Its IUPAC name is N,2-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxy-N-methylpentanamide.
| Compound Name | N,2-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxy-N-methylpentanamide |
|---|---|
| PubChem CID | 139707574 |
| Molecular Formula | C26H39NO2Si |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | N,2-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxy-N-methylpentanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(CCCO[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C26H39NO2Si/c1-26(2,3)30(5,6)29-19-13-18-24(20-22-14-9-7-10-15-22)25(28)27(4)21-23-16-11-8-12-17-23/h7-12,14-17,24H,13,18-21H2,1-6H3 |
| InChIKey | OEIXBWDXZVSOHA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|