C27H39NOSi — CID 45140883
(Z)-N,N-dibenzyl-7-triethylsilylhept-6-enamide (PubChem CID 45140883) has the molecular formula C27H39NOSi and a molecular weight of 421.70 g/mol. Its IUPAC name is (Z)-N,N-dibenzyl-7-triethylsilylhept-6-enamide.
| Compound Name | (Z)-N,N-dibenzyl-7-triethylsilylhept-6-enamide |
|---|---|
| PubChem CID | 45140883 |
| Molecular Formula | C27H39NOSi |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (Z)-N,N-dibenzyl-7-triethylsilylhept-6-enamide |
| SMILES | CC[Si](/C=C\CCCCC(=O)N(Cc1ccccc1)Cc1ccccc1)(CC)CC |
| InChI | InChI=1S/C27H39NOSi/c1-4-30(5-2,6-3)22-16-8-7-15-21-27(29)28(23-25-17-11-9-12-18-25)24-26-19-13-10-14-20-26/h9-14,16-20,22H,4-8,15,21,23-24H2,1-3H3/b22-16- |
| InChIKey | QGWPLGIGTNNLNK-JWGURIENSA-N |
| XLogP | 7.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|