C23H31NO2Si — CID 102015002
(3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one (PubChem CID 102015002) has the molecular formula C23H31NO2Si and a molecular weight of 381.59 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one |
|---|---|
| PubChem CID | 102015002 |
| Molecular Formula | C23H31NO2Si |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO2Si/c1-23(2,3)27(4,5)26-17-20-21(19-14-10-7-11-15-19)22(25)24(20)16-18-12-8-6-9-13-18/h6-15,20-21H,16-17H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | AWSAHKXLLRBLAE-RTWAWAEBSA-N |
| XLogP | 5.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|