C18H26F3NO2Si — CID 135070889
(3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)azetidin-2-one (PubChem CID 135070889) has the molecular formula C18H26F3NO2Si and a molecular weight of 373.49 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)azetidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)azetidin-2-one |
|---|---|
| PubChem CID | 135070889 |
| Molecular Formula | C18H26F3NO2Si |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethyl)azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C(F)(F)F)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H26F3NO2Si/c1-17(2,3)25(4,5)24-12-14-15(18(19,20)21)16(23)22(14)11-13-9-7-6-8-10-13/h6-10,14-15H,11-12H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | SAHFNGZNKZGCHS-CABCVRRESA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|