C24H43NO3Si2 — CID 102015004
(3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one (PubChem CID 102015004) has the molecular formula C24H43NO3Si2 and a molecular weight of 449.78 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one |
|---|---|
| PubChem CID | 102015004 |
| Molecular Formula | C24H43NO3Si2 |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H43NO3Si2/c1-23(2,3)29(7,8)27-17-20-21(18-28-30(9,10)24(4,5)6)25(22(20)26)16-19-14-12-11-13-15-19/h11-15,20-21H,16-18H2,1-10H3/t20-,21-/m1/s1 |
| InChIKey | XZQCOSAFYSKOGI-NHCUHLMSSA-N |
| XLogP | 6.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|