C21H33NO3Si — CID 15867574
(2R)-2-[(2R,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal (PubChem CID 15867574) has the molecular formula C21H33NO3Si and a molecular weight of 375.59 g/mol. Its IUPAC name is (2R)-2-[(2R,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal.
| Compound Name | (2R)-2-[(2R,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal |
|---|---|
| PubChem CID | 15867574 |
| Molecular Formula | C21H33NO3Si |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2R)-2-[(2R,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal |
| SMILES | C[C@@H](C=O)[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H33NO3Si/c1-15(14-23)19-18(16(2)25-26(6,7)21(3,4)5)20(24)22(19)13-17-11-9-8-10-12-17/h8-12,14-16,18-19H,13H2,1-7H3/t15-,16+,18+,19+/m0/s1 |
| InChIKey | CNLLLVXOLPAEES-QFHJOOASSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|