C18H28FNO2Si — CID 11325211
(3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-fluoroazetidin-2-one (PubChem CID 11325211) has the molecular formula C18H28FNO2Si and a molecular weight of 337.51 g/mol. Its IUPAC name is (3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-fluoroazetidin-2-one.
| Compound Name | (3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-fluoroazetidin-2-one |
|---|---|
| PubChem CID | 11325211 |
| Molecular Formula | C18H28FNO2Si |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-fluoroazetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(Cc2ccccc2)C1F |
| InChI | InChI=1S/C18H28FNO2Si/c1-13(22-23(5,6)18(2,3)4)15-16(19)20(17(15)21)12-14-10-8-7-9-11-14/h7-11,13,15-16H,12H2,1-6H3/t13-,15-,16?/m1/s1 |
| InChIKey | JCCXZIVHLZWBCK-CWSLVUQWSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|