C14H20FNOSi — CID 88873597
1-[(3-fluoro-4-trimethylsilylphenyl)methyl]azetidine-3-carbaldehyde (PubChem CID 88873597) has the molecular formula C14H20FNOSi and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-[(3-fluoro-4-trimethylsilylphenyl)methyl]azetidine-3-carbaldehyde.
| Compound Name | 1-[(3-fluoro-4-trimethylsilylphenyl)methyl]azetidine-3-carbaldehyde |
|---|---|
| PubChem CID | 88873597 |
| Molecular Formula | C14H20FNOSi |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[(3-fluoro-4-trimethylsilylphenyl)methyl]azetidine-3-carbaldehyde |
| SMILES | C[Si](C)(C)c1ccc(CN2CC(C=O)C2)cc1F |
| InChI | InChI=1S/C14H20FNOSi/c1-18(2,3)14-5-4-11(6-13(14)15)7-16-8-12(9-16)10-17/h4-6,10,12H,7-9H2,1-3H3 |
| InChIKey | LGLAPQAGXHRIAD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|