C20H31NO2Si — CID 15867560
(3S,4R)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethenylazetidin-2-one (PubChem CID 15867560) has the molecular formula C20H31NO2Si and a molecular weight of 345.56 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethenylazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethenylazetidin-2-one |
|---|---|
| PubChem CID | 15867560 |
| Molecular Formula | C20H31NO2Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (3S,4R)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethenylazetidin-2-one |
| SMILES | C=C[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H31NO2Si/c1-8-17-18(15(2)23-24(6,7)20(3,4)5)19(22)21(17)14-16-12-10-9-11-13-16/h8-13,15,17-18H,1,14H2,2-7H3/t15-,17-,18-/m1/s1 |
| InChIKey | WLRXMSPFZUGYJM-KBAYOESNSA-N |
| XLogP | 4.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|