C26H45NO2Si — CID 11177945
N-[(1R)-1-phenylethyl]-N-[(E)-3-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide (PubChem CID 11177945) has the molecular formula C26H45NO2Si and a molecular weight of 431.74 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-N-[(E)-3-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide.
| Compound Name | N-[(1R)-1-phenylethyl]-N-[(E)-3-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 11177945 |
| Molecular Formula | C26H45NO2Si |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-N-[(E)-3-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide |
| SMILES | CCCCCC(=O)N(C/C=C/O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H45NO2Si/c1-9-10-12-18-26(28)27(24(8)25-16-13-11-14-17-25)19-15-20-29-30(21(2)3,22(4)5)23(6)7/h11,13-17,20-24H,9-10,12,18-19H2,1-8H3/b20-15+/t24-/m1/s1 |
| InChIKey | FRZAFJZWDSNETL-NAENUDGNSA-N |
| XLogP | 7.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|