C24H38F3NO2Si — CID 134940928
2,2,2-trifluoro-N-[(3R)-5-phenylpent-1-en-3-yl]-N-[2-tri(propan-2-yl)silyloxyethyl]acetamide (PubChem CID 134940928) has the molecular formula C24H38F3NO2Si and a molecular weight of 457.65 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3R)-5-phenylpent-1-en-3-yl]-N-[2-tri(propan-2-yl)silyloxyethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3R)-5-phenylpent-1-en-3-yl]-N-[2-tri(propan-2-yl)silyloxyethyl]acetamide |
|---|---|
| PubChem CID | 134940928 |
| Molecular Formula | C24H38F3NO2Si |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3R)-5-phenylpent-1-en-3-yl]-N-[2-tri(propan-2-yl)silyloxyethyl]acetamide |
| SMILES | C=C[C@@H](CCc1ccccc1)N(CCO[Si](C(C)C)(C(C)C)C(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C24H38F3NO2Si/c1-8-22(15-14-21-12-10-9-11-13-21)28(23(29)24(25,26)27)16-17-30-31(18(2)3,19(4)5)20(6)7/h8-13,18-20,22H,1,14-17H2,2-7H3/t22-/m0/s1 |
| InChIKey | TVYZINQBXKEYHR-QFIPXVFZSA-N |
| XLogP | 6.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|