C17H20F3NOSi — CID 134923009
2,2,2-trifluoro-N-(2-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)acetamide (PubChem CID 134923009) has the molecular formula C17H20F3NOSi and a molecular weight of 339.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)acetamide |
|---|---|
| PubChem CID | 134923009 |
| Molecular Formula | C17H20F3NOSi |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)acetamide |
| SMILES | C=CC(CN(C#C[Si](C)(C)C)C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H20F3NOSi/c1-5-14(15-9-7-6-8-10-15)13-21(11-12-23(2,3)4)16(22)17(18,19)20/h5-10,14H,1,13H2,2-4H3 |
| InChIKey | CEIJRZJNWFMLJU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|