C16H21F3INOSi — CID 11812482
2,2,2-trifluoro-N-[(2-iodophenyl)methyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide (PubChem CID 11812482) has the molecular formula C16H21F3INOSi and a molecular weight of 455.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2-iodophenyl)methyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2-iodophenyl)methyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide |
|---|---|
| PubChem CID | 11812482 |
| Molecular Formula | C16H21F3INOSi |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2-iodophenyl)methyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide |
| SMILES | C[Si](C)(C)C/C=C\CN(Cc1ccccc1I)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H21F3INOSi/c1-23(2,3)11-7-6-10-21(15(22)16(17,18)19)12-13-8-4-5-9-14(13)20/h4-9H,10-12H2,1-3H3/b7-6- |
| InChIKey | VPAXRGRDGIVIMU-SREVYHEPSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|