C20H30F3NO2Si — CID 135054227
N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide (PubChem CID 135054227) has the molecular formula C20H30F3NO2Si and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide.
| Compound Name | N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 135054227 |
| Molecular Formula | C20H30F3NO2Si |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)N(CCc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H30F3NO2Si/c1-7-17(15-26-27(5,6)19(2,3)4)24(18(25)20(21,22)23)14-13-16-11-9-8-10-12-16/h7-12,17H,1,13-15H2,2-6H3/t17-/m1/s1 |
| InChIKey | RCENOFDVCPCYDA-QGZVFWFLSA-N |
| XLogP | 5.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|