C18H29NO2Si — CID 102014999
(3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylazetidin-2-one (PubChem CID 102014999) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylazetidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 102014999 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (3S,4S)-1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylazetidin-2-one |
| SMILES | C[C@@H]1C(=O)N(Cc2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO2Si/c1-14-16(13-21-22(5,6)18(2,3)4)19(17(14)20)12-15-10-8-7-9-11-15/h7-11,14,16H,12-13H2,1-6H3/t14-,16+/m0/s1 |
| InChIKey | FEOWKCYAKLYUGD-GOEBONIOSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|