C20H31NO4Si — CID 102015005
ethyl 2-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylazetidin-1-yl]acetate (PubChem CID 102015005) has the molecular formula C20H31NO4Si and a molecular weight of 377.56 g/mol. Its IUPAC name is ethyl 2-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylazetidin-1-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 102015005 |
| Molecular Formula | C20H31NO4Si |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 2-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylazetidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@@H](c2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31NO4Si/c1-7-24-17(22)13-21-16(14-25-26(5,6)20(2,3)4)18(19(21)23)15-11-9-8-10-12-15/h8-12,16,18H,7,13-14H2,1-6H3/t16-,18-/m0/s1 |
| InChIKey | ZXYCPPISKMDPOA-WMZOPIPTSA-N |
| XLogP | 3.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|