C18H29NO2Si — CID 135019709
(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-4-phenylpyrrolidin-2-one (PubChem CID 135019709) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is (4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-4-phenylpyrrolidin-2-one.
| Compound Name | (4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 135019709 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-4-phenylpyrrolidin-2-one |
| SMILES | CN1C(=O)C[C@H](c2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO2Si/c1-18(2,3)22(5,6)21-13-16-15(12-17(20)19(16)4)14-10-8-7-9-11-14/h7-11,15-16H,12-13H2,1-6H3/t15-,16+/m1/s1 |
| InChIKey | FMLBDVITJBJPMP-CVEARBPZSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|