C27H33NO2Si — CID 56593004
(2S)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropanamide (PubChem CID 56593004) has the molecular formula C27H33NO2Si and a molecular weight of 431.65 g/mol. Its IUPAC name is (2S)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropanamide.
| Compound Name | (2S)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropanamide |
|---|---|
| PubChem CID | 56593004 |
| Molecular Formula | C27H33NO2Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (2S)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropanamide |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H33NO2Si/c1-22(26(29)28-20-23-14-8-5-9-15-23)21-30-31(27(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22H,20-21H2,1-4H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | KZTNYZOIEZWGHL-QFIPXVFZSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|