C27H31NO2Si — CID 141398580
(4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylpyrrolidin-2-one (PubChem CID 141398580) has the molecular formula C27H31NO2Si and a molecular weight of 429.64 g/mol. Its IUPAC name is (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylpyrrolidin-2-one.
| Compound Name | (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 141398580 |
| Molecular Formula | C27H31NO2Si |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylpyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1CC(=O)N[C@@H]1c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO2Si/c1-27(2,3)31(23-15-9-5-10-16-23,24-17-11-6-12-18-24)30-20-22-19-25(29)28-26(22)21-13-7-4-8-14-21/h4-18,22,26H,19-20H2,1-3H3,(H,28,29)/t22-,26-/m1/s1 |
| InChIKey | NMDZZWJNLRAKDI-ATIYNZHBSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|