C19H33NO2Si — CID 135031643
5-[tert-butyl(dimethyl)silyl]oxy-N-(2-phenylethyl)pentanamide (PubChem CID 135031643) has the molecular formula C19H33NO2Si and a molecular weight of 335.56 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-N-(2-phenylethyl)pentanamide.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 135031643 |
| Molecular Formula | C19H33NO2Si |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-N-(2-phenylethyl)pentanamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C19H33NO2Si/c1-19(2,3)23(4,5)22-16-10-9-13-18(21)20-15-14-17-11-7-6-8-12-17/h6-8,11-12H,9-10,13-16H2,1-5H3,(H,20,21) |
| InChIKey | UXFCRECLMRIPLU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|