C26H39NO3Si — CID 10884719
methyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pentanoate (PubChem CID 10884719) has the molecular formula C26H39NO3Si and a molecular weight of 441.69 g/mol. Its IUPAC name is methyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pentanoate.
| Compound Name | methyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pentanoate |
|---|---|
| PubChem CID | 10884719 |
| Molecular Formula | C26H39NO3Si |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | methyl (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pentanoate |
| SMILES | COC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H39NO3Si/c1-21(24(18-25(28)29-5)30-31(6,7)26(2,3)4)27(19-22-14-10-8-11-15-22)20-23-16-12-9-13-17-23/h8-17,21,24H,18-20H2,1-7H3/t21-,24+/m0/s1 |
| InChIKey | NTSJOEXWUDQWSD-XUZZJYLKSA-N |
| XLogP | 6.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|