C31H48FNO3Si — CID 135064651
tert-butyl (2S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6-[tert-butyl(dimethyl)silyl]oxy-2-fluorohexanoate (PubChem CID 135064651) has the molecular formula C31H48FNO3Si and a molecular weight of 529.81 g/mol. Its IUPAC name is tert-butyl (2S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6-[tert-butyl(dimethyl)silyl]oxy-2-fluorohexanoate.
| Compound Name | tert-butyl (2S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6-[tert-butyl(dimethyl)silyl]oxy-2-fluorohexanoate |
|---|---|
| PubChem CID | 135064651 |
| Molecular Formula | C31H48FNO3Si |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | tert-butyl (2S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6-[tert-butyl(dimethyl)silyl]oxy-2-fluorohexanoate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)C(CCCO[Si](C)(C)C(C)(C)C)[C@H](F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H48FNO3Si/c1-24(26-19-14-11-15-20-26)33(23-25-17-12-10-13-18-25)27(28(32)29(34)36-30(2,3)4)21-16-22-35-37(8,9)31(5,6)7/h10-15,17-20,24,27-28H,16,21-23H2,1-9H3/t24-,27?,28-/m0/s1 |
| InChIKey | GYELWRQKXZSYKS-VVENGHIQSA-N |
| XLogP | 8.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|