C20H31F2NO2Si — CID 164675464
2-trimethylsilylethyl 3-(azepan-1-yl)-2,2-difluoro-3-phenylpropanoate (PubChem CID 164675464) has the molecular formula C20H31F2NO2Si and a molecular weight of 383.56 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-(azepan-1-yl)-2,2-difluoro-3-phenylpropanoate.
| Compound Name | 2-trimethylsilylethyl 3-(azepan-1-yl)-2,2-difluoro-3-phenylpropanoate |
|---|---|
| PubChem CID | 164675464 |
| Molecular Formula | C20H31F2NO2Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-trimethylsilylethyl 3-(azepan-1-yl)-2,2-difluoro-3-phenylpropanoate |
| SMILES | C[Si](C)(C)CCOC(=O)C(F)(F)C(c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C20H31F2NO2Si/c1-26(2,3)16-15-25-19(24)20(21,22)18(17-11-7-6-8-12-17)23-13-9-4-5-10-14-23/h6-8,11-12,18H,4-5,9-10,13-16H2,1-3H3 |
| InChIKey | KEWAWFRAMAJGKM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|