C17H25F2NO3Si — CID 154721079
ethyl 4-acetamido-2,2-difluoro-4-(4-trimethylsilylphenyl)butanoate (PubChem CID 154721079) has the molecular formula C17H25F2NO3Si and a molecular weight of 357.47 g/mol. Its IUPAC name is ethyl 4-acetamido-2,2-difluoro-4-(4-trimethylsilylphenyl)butanoate.
| Compound Name | ethyl 4-acetamido-2,2-difluoro-4-(4-trimethylsilylphenyl)butanoate |
|---|---|
| PubChem CID | 154721079 |
| Molecular Formula | C17H25F2NO3Si |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethyl 4-acetamido-2,2-difluoro-4-(4-trimethylsilylphenyl)butanoate |
| SMILES | CCOC(=O)C(F)(F)CC(NC(C)=O)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H25F2NO3Si/c1-6-23-16(22)17(18,19)11-15(20-12(2)21)13-7-9-14(10-8-13)24(3,4)5/h7-10,15H,6,11H2,1-5H3,(H,20,21) |
| InChIKey | CDHXYWHAQNKNAA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|