C30H45NO3Si — CID 11785238
(3R)-3-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolan-2-one (PubChem CID 11785238) has the molecular formula C30H45NO3Si and a molecular weight of 495.78 g/mol. Its IUPAC name is (3R)-3-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolan-2-one.
| Compound Name | (3R)-3-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolan-2-one |
|---|---|
| PubChem CID | 11785238 |
| Molecular Formula | C30H45NO3Si |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | (3R)-3-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methylpentyl]oxolan-2-one |
| SMILES | CC(C)C[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCOC1=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H45NO3Si/c1-23(2)20-27(28(26-18-19-33-29(26)32)34-35(6,7)30(3,4)5)31(21-24-14-10-8-11-15-24)22-25-16-12-9-13-17-25/h8-17,23,26-28H,18-22H2,1-7H3/t26-,27+,28-/m1/s1 |
| InChIKey | VBNWSZZKILVCEM-OZNIXHKMSA-N |
| XLogP | 7.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|